C14H27NO2 — CID 123166371
(9R,10S)-10-hydroxy-N,N,9-trimethylundec-6-enamide (PubChem CID 123166371) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is (9R,10S)-10-hydroxy-N,N,9-trimethylundec-6-enamide.
| Compound Name | (9R,10S)-10-hydroxy-N,N,9-trimethylundec-6-enamide |
|---|---|
| PubChem CID | 123166371 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | (9R,10S)-10-hydroxy-N,N,9-trimethylundec-6-enamide |
| SMILES | C[C@H](O)[C@H](C)CC=CCCCCC(=O)N(C)C |
| InChI | InChI=1S/C14H27NO2/c1-12(13(2)16)10-8-6-5-7-9-11-14(17)15(3)4/h6,8,12-13,16H,5,7,9-11H2,1-4H3/t12-,13+/m1/s1 |
| InChIKey | AAHFTDGJDXPGIB-OLZOCXBDSA-N |
| XLogP | 2.60 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|