C22H40N2O9SSi2 — CID 123166478
[(6aR,8S,9aS)-8-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] methanesulfonate (PubChem CID 123166478) has the molecular formula C22H40N2O9SSi2 and a molecular weight of 564.81 g/mol. Its IUPAC name is [(6aR,8S,9aS)-8-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] methanesulfonate.
| Compound Name | [(6aR,8S,9aS)-8-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] methanesulfonate |
|---|---|
| PubChem CID | 123166478 |
| Molecular Formula | C22H40N2O9SSi2 |
| Molecular Weight | 564.81 g/mol |
| Exact Mass | 564.20 |
| IUPAC Name | [(6aR,8S,9aS)-8-(2,4-dioxo-1H-pyrimidin-5-yl)-2,2,4,4-tetra(propan-2-yl)-6a,8,9,9a-tetrahydro-6H-furo[3,2-f][1,3,5,2,4]trioxadisilocin-9-yl] methanesulfonate |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@H]2O[C@@H](c3c[nH]c(=O)[nH]c3=O)C(OS(C)(=O)=O)[C@H]2O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C22H40N2O9SSi2/c1-12(2)35(13(3)4)29-11-17-19(32-36(33-35,14(5)6)15(7)8)20(31-34(9,27)28)18(30-17)16-10-23-22(26)24-21(16)25/h10,12-15,17-20H,11H2,1-9H3,(H2,23,24,25,26)/t17-,18+,19+,20?/m1/s1 |
| InChIKey | XDWVDOXJOOHWDW-QYRWZOIFSA-N |
| XLogP | 2.80 |
| TPSA | 146.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.81 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|