About 2,4,7-trimethyl-1,7a-dihydrobenzotriazole
2,4,7-trimethyl-1,7a-dihydrobenzotriazole (PubChem CID 123166588) has the molecular formula C9H13N3
and a molecular weight of 163.22 g/mol. Its IUPAC name is 2,4,7-trimethyl-1,7a-dihydrobenzotriazole.
Molecular Properties
| Compound Name | 2,4,7-trimethyl-1,7a-dihydrobenzotriazole |
| PubChem CID | 123166588 |
| Molecular Formula | C9H13N3 |
| Molecular Weight | 163.22 g/mol |
| Exact Mass | 163.11 |
| IUPAC Name | 2,4,7-trimethyl-1,7a-dihydrobenzotriazole |
| SMILES | CC1=CC=C(C)C2NN(C)N=C12 |
| InChI | InChI=1S/C9H13N3/c1-6-4-5-7(2)9-8(6)10-12(3)11-9/h4-5,8,10H,1-3H3 |
| InChIKey | UXTNMXTWLRQKOJ-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.22 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4,7-trimethyl-1,7a-dihydrobenzotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4,7-trimethyl-1,7a-dihydrobenzotriazole?
The IUPAC name of 2,4,7-trimethyl-1,7a-dihydrobenzotriazole (CID 123166588) is 2,4,7-trimethyl-1,7a-dihydrobenzotriazole.
What is the SMILES notation for 2,4,7-trimethyl-1,7a-dihydrobenzotriazole?
The canonical SMILES for 2,4,7-trimethyl-1,7a-dihydrobenzotriazole is CC1=CC=C(C)C2NN(C)N=C12.
What is the InChIKey of 2,4,7-trimethyl-1,7a-dihydrobenzotriazole?
The InChIKey is UXTNMXTWLRQKOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3/c1-6-4-5-7(2)9-8(6)10-12(3)11-9/h4-5,8,10H,1-3H3.
What are the key properties of 2,4,7-trimethyl-1,7a-dihydrobenzotriazole?
2,4,7-trimethyl-1,7a-dihydrobenzotriazole has a molecular weight of 163.22 g/mol, XLogP of 1.07, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4,7-trimethyl-1,7a-dihydrobenzotriazole is sourced from PubChem (CID 123166588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).