C15H20O3S — CID 123166721
1-(5,6-dimethylcycloocta-1,3,5-trien-1-yl)-4-methylsulfonylbut-2-en-1-one (PubChem CID 123166721) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 1-(5,6-dimethylcycloocta-1,3,5-trien-1-yl)-4-methylsulfonylbut-2-en-1-one.
| Compound Name | 1-(5,6-dimethylcycloocta-1,3,5-trien-1-yl)-4-methylsulfonylbut-2-en-1-one |
|---|---|
| PubChem CID | 123166721 |
| Molecular Formula | C15H20O3S |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-(5,6-dimethylcycloocta-1,3,5-trien-1-yl)-4-methylsulfonylbut-2-en-1-one |
| SMILES | CC1=C(C)CCC(C(=O)C=CCS(C)(=O)=O)=CC=C1 |
| InChI | InChI=1S/C15H20O3S/c1-12-6-4-7-14(10-9-13(12)2)15(16)8-5-11-19(3,17)18/h4-8H,9-11H2,1-3H3 |
| InChIKey | HCXNUOJYEGMDHO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|