C12H17Cl2N5O3 — CID 123167210
4-(5,7-dichloro-1,2-dihydrotriazolo[4,5-d]pyrimidin-3-yl)-2-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol (PubChem CID 123167210) has the molecular formula C12H17Cl2N5O3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 4-(5,7-dichloro-1,2-dihydrotriazolo[4,5-d]pyrimidin-3-yl)-2-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol.
| Compound Name | 4-(5,7-dichloro-1,2-dihydrotriazolo[4,5-d]pyrimidin-3-yl)-2-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol |
|---|---|
| PubChem CID | 123167210 |
| Molecular Formula | C12H17Cl2N5O3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 4-(5,7-dichloro-1,2-dihydrotriazolo[4,5-d]pyrimidin-3-yl)-2-(2-hydroxypropan-2-yloxy)cyclopentan-1-ol |
| SMILES | CC(C)(O)OC1CC(N2NNc3c(Cl)nc(Cl)nc32)CC1O |
| InChI | InChI=1S/C12H17Cl2N5O3/c1-12(2,21)22-7-4-5(3-6(7)20)19-10-8(17-18-19)9(13)15-11(14)16-10/h5-7,17-18,20-21H,3-4H2,1-2H3 |
| InChIKey | ILXVVFPIOJCREO-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|