C30H43N2O2+ — CID 123167358
(5E)-4,6-dimethylidene-N-(2-morpholin-4-ylethyl)-5-[(2Z)-3-prop-1-en-2-yl-6-propylnona-2,8-dienylidene]cyclohexene-1-carboxamide (PubChem CID 123167358) has the molecular formula C30H43N2O2+ and a molecular weight of 463.69 g/mol. Its IUPAC name is (5E)-4,6-dimethylidene-N-(2-morpholin-4-ylethyl)-5-[(2Z)-3-prop-1-en-2-yl-6-propylnona-2,8-dienylidene]cyclohexene-1-carboxamide.
| Compound Name | (5E)-4,6-dimethylidene-N-(2-morpholin-4-ylethyl)-5-[(2Z)-3-prop-1-en-2-yl-6-propylnona-2,8-dienylidene]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 123167358 |
| Molecular Formula | C30H43N2O2+ |
| Molecular Weight | 463.69 g/mol |
| Exact Mass | 463.33 |
| IUPAC Name | (5E)-4,6-dimethylidene-N-(2-morpholin-4-ylethyl)-5-[(2Z)-3-prop-1-en-2-yl-6-propylnona-2,8-dienylidene]cyclohexene-1-carboxamide |
| SMILES | C=CCC(CCC)CC/C(=C/C=C1\C(=C)[CH+]C=C(C(=O)NCCN2CCOCC2)C1=C)C(=C)C |
| InChI | InChI=1S/C30H42N2O2/c1-7-9-26(10-8-2)12-13-27(23(3)4)14-16-28-24(5)11-15-29(25(28)6)30(33)31-17-18-32-19-21-34-22-20-32/h7,11,14-16,26H,1,3,5-6,8-10,12-13,17-22H2,2,4H3/p+1/b27-14-,28-16+ |
| InChIKey | VVLNEVXNFVKAPI-CHBMVJRYSA-O |
| XLogP | 5.89 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.69 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|