About 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate
6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate (PubChem CID 123167668) has the molecular formula C16H29NO3
and a molecular weight of 283.41 g/mol. Its IUPAC name is 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate.
Molecular Properties
| Compound Name | 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate |
| PubChem CID | 123167668 |
| Molecular Formula | C16H29NO3 |
| Molecular Weight | 283.41 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate |
| SMILES | CC(C)C(C)(C(=O)OCC1CC2CC(C1)O2)C(C)(C)N |
| InChI | InChI=1S/C16H29NO3/c1-10(2)16(5,15(3,4)17)14(18)19-9-11-6-12-8-13(7-11)20-12/h10-13H,6-9,17H2,1-5H3 |
| InChIKey | RVZSLNWWFNBXCH-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.41 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate?
The IUPAC name of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate (CID 123167668) is 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate.
What is the SMILES notation for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate?
The canonical SMILES for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate is CC(C)C(C)(C(=O)OCC1CC2CC(C1)O2)C(C)(C)N.
What is the InChIKey of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate?
The InChIKey is RVZSLNWWFNBXCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H29NO3/c1-10(2)16(5,15(3,4)17)14(18)19-9-11-6-12-8-13(7-11)20-12/h10-13H,6-9,17H2,1-5H3.
What are the key properties of 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate?
6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate has a molecular weight of 283.41 g/mol, XLogP of 2.50, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxabicyclo[3.1.1]heptan-3-ylmethyl 3-amino-2,3-dimethyl-2-propan-2-ylbutanoate is sourced from PubChem (CID 123167668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).