About (Z)-N,4,5-trimethylhept-3-en-2-imine
(Z)-N,4,5-trimethylhept-3-en-2-imine (PubChem CID 123168461) has the molecular formula C10H19N
and a molecular weight of 153.27 g/mol. Its IUPAC name is (Z)-N,4,5-trimethylhept-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-N,4,5-trimethylhept-3-en-2-imine |
| PubChem CID | 123168461 |
| Molecular Formula | C10H19N |
| Molecular Weight | 153.27 g/mol |
| Exact Mass | 153.15 |
| IUPAC Name | (Z)-N,4,5-trimethylhept-3-en-2-imine |
| SMILES | CCC(C)/C(C)=C\C(C)=N\C |
| InChI | InChI=1S/C10H19N/c1-6-8(2)9(3)7-10(4)11-5/h7-8H,6H2,1-5H3/b9-7-,11-10+ |
| InChIKey | MZIIFRKBHWQBOM-NKTIYDDZSA-N |
| XLogP | 3.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.27 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-N,4,5-trimethylhept-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,4,5-trimethylhept-3-en-2-imine?
The IUPAC name of (Z)-N,4,5-trimethylhept-3-en-2-imine (CID 123168461) is (Z)-N,4,5-trimethylhept-3-en-2-imine.
What is the SMILES notation for (Z)-N,4,5-trimethylhept-3-en-2-imine?
The canonical SMILES for (Z)-N,4,5-trimethylhept-3-en-2-imine is CCC(C)/C(C)=C\C(C)=N\C.
What is the InChIKey of (Z)-N,4,5-trimethylhept-3-en-2-imine?
The InChIKey is MZIIFRKBHWQBOM-NKTIYDDZSA-N. The full InChI is InChI=1S/C10H19N/c1-6-8(2)9(3)7-10(4)11-5/h7-8H,6H2,1-5H3/b9-7-,11-10+.
What are the key properties of (Z)-N,4,5-trimethylhept-3-en-2-imine?
(Z)-N,4,5-trimethylhept-3-en-2-imine has a molecular weight of 153.27 g/mol, XLogP of 3.07, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,4,5-trimethylhept-3-en-2-imine is sourced from PubChem (CID 123168461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).