C35H70S — CID 123168526
1,3,3,5,5,7,7-heptamethyl-2,6-bis(2,4,4,5-tetramethylhexan-2-yl)cyclooctane-1-thiol (PubChem CID 123168526) has the molecular formula C35H70S and a molecular weight of 523.01 g/mol. Its IUPAC name is 1,3,3,5,5,7,7-heptamethyl-2,6-bis(2,4,4,5-tetramethylhexan-2-yl)cyclooctane-1-thiol.
| Compound Name | 1,3,3,5,5,7,7-heptamethyl-2,6-bis(2,4,4,5-tetramethylhexan-2-yl)cyclooctane-1-thiol |
|---|---|
| PubChem CID | 123168526 |
| Molecular Formula | C35H70S |
| Molecular Weight | 523.01 g/mol |
| Exact Mass | 522.52 |
| IUPAC Name | 1,3,3,5,5,7,7-heptamethyl-2,6-bis(2,4,4,5-tetramethylhexan-2-yl)cyclooctane-1-thiol |
| SMILES | CC(C)C(C)(C)CC(C)(C)C1C(C)(C)CC(C)(C)C(C(C)(C)CC(C)(C)C(C)C)C(C)(S)CC1(C)C |
| InChI | InChI=1S/C35H70S/c1-24(2)28(5,6)20-30(9,10)26-31(11,12)22-33(15,16)27(35(19,36)23-34(26,17)18)32(13,14)21-29(7,8)25(3)4/h24-27,36H,20-23H2,1-19H3 |
| InChIKey | GJPSEGGPKUPOLB-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.01 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|