C26H25F3N6O2S — CID 123168694
6-[[2-[4-[[[8-(trifluoromethyl)quinolin-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiomorpholine-2,5-dione (PubChem CID 123168694) has the molecular formula C26H25F3N6O2S and a molecular weight of 542.59 g/mol. Its IUPAC name is 6-[[2-[4-[[[8-(trifluoromethyl)quinolin-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiomorpholine-2,5-dione.
| Compound Name | 6-[[2-[4-[[[8-(trifluoromethyl)quinolin-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiomorpholine-2,5-dione |
|---|---|
| PubChem CID | 123168694 |
| Molecular Formula | C26H25F3N6O2S |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 6-[[2-[4-[[[8-(trifluoromethyl)quinolin-2-yl]methylamino]methyl]piperidin-1-yl]pyrimidin-4-yl]methylidene]thiomorpholine-2,5-dione |
| SMILES | O=C1CNC(=O)C(=Cc2ccnc(N3CCC(CNCc4ccc5cccc(C(F)(F)F)c5n4)CC3)n2)S1 |
| InChI | InChI=1S/C26H25F3N6O2S/c27-26(28,29)20-3-1-2-17-4-5-19(33-23(17)20)14-30-13-16-7-10-35(11-8-16)25-31-9-6-18(34-25)12-21-24(37)32-15-22(36)38-21/h1-6,9,12,16,30H,7-8,10-11,13-15H2,(H,32,37) |
| InChIKey | ZNDUPQZYCMVTNW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 100.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|