C37H56O — CID 123168999
10-(2,6-dimethylhepta-2,4,6-trienyl)-4-ethylidene-18-methoxy-6,7,13-trimethyldocosa-1,2,10,15,17,19-hexaene (PubChem CID 123168999) has the molecular formula C37H56O and a molecular weight of 516.85 g/mol. Its IUPAC name is 10-(2,6-dimethylhepta-2,4,6-trienyl)-4-ethylidene-18-methoxy-6,7,13-trimethyldocosa-1,2,10,15,17,19-hexaene.
| Compound Name | 10-(2,6-dimethylhepta-2,4,6-trienyl)-4-ethylidene-18-methoxy-6,7,13-trimethyldocosa-1,2,10,15,17,19-hexaene |
|---|---|
| PubChem CID | 123168999 |
| Molecular Formula | C37H56O |
| Molecular Weight | 516.85 g/mol |
| Exact Mass | 516.43 |
| IUPAC Name | 10-(2,6-dimethylhepta-2,4,6-trienyl)-4-ethylidene-18-methoxy-6,7,13-trimethyldocosa-1,2,10,15,17,19-hexaene |
| SMILES | C=C=CC(=CC)CC(C)C(C)CCC(=CCC(C)CC=CC=C(C=CCC)OC)CC(C)=CC=CC(=C)C |
| InChI | InChI=1S/C37H56O/c1-11-14-22-37(38-10)23-16-15-20-31(6)24-26-36(28-32(7)21-17-19-30(4)5)27-25-33(8)34(9)29-35(13-3)18-12-2/h13-19,21-23,26,31,33-34H,2,4,11,20,24-25,27-29H2,1,3,5-10H3 |
| InChIKey | YHQQQDWMKFHZAR-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.85 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|