C22H36N4O — CID 123169079
4-[(4-ethylpiperazin-1-yl)methyl]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide (PubChem CID 123169079) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is 4-[(4-ethylpiperazin-1-yl)methyl]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide.
| Compound Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 123169079 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | 4-[(4-ethylpiperazin-1-yl)methyl]-N-methyl-N-(2-piperidin-1-ylethyl)benzamide |
| SMILES | CCN1CCN(Cc2ccc(C(=O)N(C)CCN3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H36N4O/c1-3-24-15-17-26(18-16-24)19-20-7-9-21(10-8-20)22(27)23(2)13-14-25-11-5-4-6-12-25/h7-10H,3-6,11-19H2,1-2H3 |
| InChIKey | JVDYIOVXXIUSJL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |