C10H8F3NO4S — CID 123169723
4-(trifluoromethylsulfonyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol (PubChem CID 123169723) has the molecular formula C10H8F3NO4S and a molecular weight of 295.24 g/mol. Its IUPAC name is 4-(trifluoromethylsulfonyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol.
| Compound Name | 4-(trifluoromethylsulfonyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
|---|---|
| PubChem CID | 123169723 |
| Molecular Formula | C10H8F3NO4S |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 4-(trifluoromethylsulfonyl)-4-azatricyclo[5.2.1.02,6]deca-2,5,8-triene-3,5-diol |
| SMILES | O=S(=O)(n1c(O)c2c(c1O)C1C=CC2C1)C(F)(F)F |
| InChI | InChI=1S/C10H8F3NO4S/c11-10(12,13)19(17,18)14-8(15)6-4-1-2-5(3-4)7(6)9(14)16/h1-2,4-5,15-16H,3H2 |
| InChIKey | LPFBQBGIWWOLPL-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 79.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|