C11H22N2 — CID 123170311
2-ethylnona-4,8-dienylhydrazine (PubChem CID 123170311) has the molecular formula C11H22N2 and a molecular weight of 182.31 g/mol. Its IUPAC name is 2-ethylnona-4,8-dienylhydrazine.
| Compound Name | 2-ethylnona-4,8-dienylhydrazine |
|---|---|
| PubChem CID | 123170311 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 2-ethylnona-4,8-dienylhydrazine |
| SMILES | C=CCCC=CCC(CC)CNN |
| InChI | InChI=1S/C11H22N2/c1-3-5-6-7-8-9-11(4-2)10-13-12/h3,7-8,11,13H,1,4-6,9-10,12H2,2H3 |
| InChIKey | AKAALYYWTDBPCX-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|