About 4-butyl-1,4-diazepan-1-amine
4-butyl-1,4-diazepan-1-amine (PubChem CID 123170319) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 4-butyl-1,4-diazepan-1-amine.
Molecular Properties
| Compound Name | 4-butyl-1,4-diazepan-1-amine |
| PubChem CID | 123170319 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 4-butyl-1,4-diazepan-1-amine |
| SMILES | CCCCN1CCCN(N)CC1 |
| InChI | InChI=1S/C9H21N3/c1-2-3-5-11-6-4-7-12(10)9-8-11/h2-10H2,1H3 |
| InChIKey | WVNVIHMPOUURHE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 4-butyl-1,4-diazepan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-1,4-diazepan-1-amine?
The IUPAC name of 4-butyl-1,4-diazepan-1-amine (CID 123170319) is 4-butyl-1,4-diazepan-1-amine.
What is the SMILES notation for 4-butyl-1,4-diazepan-1-amine?
The canonical SMILES for 4-butyl-1,4-diazepan-1-amine is CCCCN1CCCN(N)CC1.
What is the InChIKey of 4-butyl-1,4-diazepan-1-amine?
The InChIKey is WVNVIHMPOUURHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-2-3-5-11-6-4-7-12(10)9-8-11/h2-10H2,1H3.
What are the key properties of 4-butyl-1,4-diazepan-1-amine?
4-butyl-1,4-diazepan-1-amine has a molecular weight of 171.29 g/mol, XLogP of 0.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-1,4-diazepan-1-amine is sourced from PubChem (CID 123170319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).