About 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide
4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide (PubChem CID 123170342) has the molecular formula C17H23FN4O4S
and a molecular weight of 398.46 g/mol. Its IUPAC name is 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide.
Molecular Properties
| Compound Name | 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide |
| PubChem CID | 123170342 |
| Molecular Formula | C17H23FN4O4S |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide |
| SMILES | NC(=NO)N1CCN(C(=O)C2CCS(=O)(=O)CC2)C(c2ccccc2F)C1 |
| InChI | InChI=1S/C17H23FN4O4S/c18-14-4-2-1-3-13(14)15-11-21(17(19)20-24)7-8-22(15)16(23)12-5-9-27(25,26)10-6-12/h1-4,12,15,24H,5-11H2,(H2,19,20) |
| InChIKey | JXODNKINERDWBV-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 116.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide?
The IUPAC name of 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide (CID 123170342) is 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide.
What is the SMILES notation for 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide?
The canonical SMILES for 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide is NC(=NO)N1CCN(C(=O)C2CCS(=O)(=O)CC2)C(c2ccccc2F)C1.
What is the InChIKey of 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide?
The InChIKey is JXODNKINERDWBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H23FN4O4S/c18-14-4-2-1-3-13(14)15-11-21(17(19)20-24)7-8-22(15)16(23)12-5-9-27(25,26)10-6-12/h1-4,12,15,24H,5-11H2,(H2,19,20).
What are the key properties of 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide?
4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide has a molecular weight of 398.46 g/mol, XLogP of 0.54, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,1-dioxothiane-4-carbonyl)-3-(2-fluorophenyl)-N'-hydroxypiperazine-1-carboximidamide is sourced from PubChem (CID 123170342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).