C20H35BN2O2 — CID 123170959
N-methyl-N'-pentyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-diamine (PubChem CID 123170959) has the molecular formula C20H35BN2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is N-methyl-N'-pentyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-diamine.
| Compound Name | N-methyl-N'-pentyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 123170959 |
| Molecular Formula | C20H35BN2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.28 |
| IUPAC Name | N-methyl-N'-pentyl-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethane-1,2-diamine |
| SMILES | CCCCCNCC(NC)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1 |
| InChI | InChI=1S/C20H35BN2O2/c1-7-8-9-14-23-15-18(22-6)16-10-12-17(13-11-16)21-24-19(2,3)20(4,5)25-21/h10-13,18,22-23H,7-9,14-15H2,1-6H3 |
| InChIKey | PSPBIVJMSBJUFN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|