C20H30O5 — CID 123171347
(1'R,2R,4'R,9'S,10'S,13'R)-11',13'-dihydroxy-5',9'-dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid (PubChem CID 123171347) has the molecular formula C20H30O5 and a molecular weight of 350.46 g/mol. Its IUPAC name is (1'R,2R,4'R,9'S,10'S,13'R)-11',13'-dihydroxy-5',9'-dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid.
| Compound Name | (1'R,2R,4'R,9'S,10'S,13'R)-11',13'-dihydroxy-5',9'-dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid |
|---|---|
| PubChem CID | 123171347 |
| Molecular Formula | C20H30O5 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | (1'R,2R,4'R,9'S,10'S,13'R)-11',13'-dihydroxy-5',9'-dimethylspiro[oxirane-2,14'-tetracyclo[11.2.1.01,10.04,9]hexadecane]-5'-carboxylic acid |
| SMILES | CC1(C(=O)O)CCC[C@@]2(C)[C@H]1CC[C@]13C[C@@](O)(CC(O)[C@@H]12)[C@]1(CO1)C3 |
| InChI | InChI=1S/C20H30O5/c1-16-5-3-6-17(2,15(22)23)13(16)4-7-18-9-19(24,8-12(21)14(16)18)20(10-18)11-25-20/h12-14,21,24H,3-11H2,1-2H3,(H,22,23)/t12?,13-,14-,16+,17?,18-,19+,20-/m1/s1 |
| InChIKey | MXMFFSBSLVZIBB-QVWFVKEESA-N |
| XLogP | 2.34 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|