C26H26ClFN8 — CID 123171783
N-[(6-chloro-3-ethyl-1H-indol-2-yl)methyl]-9-(3-fluorophenyl)-2-piperazin-1-ylpurin-6-amine (PubChem CID 123171783) has the molecular formula C26H26ClFN8 and a molecular weight of 505.00 g/mol. Its IUPAC name is N-[(6-chloro-3-ethyl-1H-indol-2-yl)methyl]-9-(3-fluorophenyl)-2-piperazin-1-ylpurin-6-amine.
| Compound Name | N-[(6-chloro-3-ethyl-1H-indol-2-yl)methyl]-9-(3-fluorophenyl)-2-piperazin-1-ylpurin-6-amine |
|---|---|
| PubChem CID | 123171783 |
| Molecular Formula | C26H26ClFN8 |
| Molecular Weight | 505.00 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-[(6-chloro-3-ethyl-1H-indol-2-yl)methyl]-9-(3-fluorophenyl)-2-piperazin-1-ylpurin-6-amine |
| SMILES | CCc1c(CNc2nc(N3CCNCC3)nc3c2ncn3-c2cccc(F)c2)[nH]c2cc(Cl)ccc12 |
| InChI | InChI=1S/C26H26ClFN8/c1-2-19-20-7-6-16(27)12-21(20)32-22(19)14-30-24-23-25(34-26(33-24)35-10-8-29-9-11-35)36(15-31-23)18-5-3-4-17(28)13-18/h3-7,12-13,15,29,32H,2,8-11,14H2,1H3,(H,30,33,34) |
| InChIKey | ILLJPSCYQZUHAY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.00 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|