C14H27N — CID 123171830
N,N,3,6-tetramethyldeca-3,5-dien-4-amine (PubChem CID 123171830) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is N,N,3,6-tetramethyldeca-3,5-dien-4-amine.
| Compound Name | N,N,3,6-tetramethyldeca-3,5-dien-4-amine |
|---|---|
| PubChem CID | 123171830 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | N,N,3,6-tetramethyldeca-3,5-dien-4-amine |
| SMILES | CCCCC(C)=CC(=C(C)CC)N(C)C |
| InChI | InChI=1S/C14H27N/c1-7-9-10-12(3)11-14(15(5)6)13(4)8-2/h11H,7-10H2,1-6H3 |
| InChIKey | MVXBMZXXAIOOAE-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|