About 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one
4-butyl-5-hydroxy-3H-1,3-oxazol-2-one (PubChem CID 123172052) has the molecular formula C7H11NO3
and a molecular weight of 157.17 g/mol. Its IUPAC name is 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one.
Molecular Properties
| Compound Name | 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one |
| PubChem CID | 123172052 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one |
| SMILES | CCCCc1[nH]c(=O)oc1O |
| InChI | InChI=1S/C7H11NO3/c1-2-3-4-5-6(9)11-7(10)8-5/h9H,2-4H2,1H3,(H,8,10) |
| InChIKey | YNLOIIHHUFEIQP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one?
The IUPAC name of 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one (CID 123172052) is 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one.
What is the SMILES notation for 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one?
The canonical SMILES for 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one is CCCCc1[nH]c(=O)oc1O.
What is the InChIKey of 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one?
The InChIKey is YNLOIIHHUFEIQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO3/c1-2-3-4-5-6(9)11-7(10)8-5/h9H,2-4H2,1H3,(H,8,10).
What are the key properties of 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one?
4-butyl-5-hydroxy-3H-1,3-oxazol-2-one has a molecular weight of 157.17 g/mol, XLogP of 1.02, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butyl-5-hydroxy-3H-1,3-oxazol-2-one is sourced from PubChem (CID 123172052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).