C27H34FN4O9P — CID 123172347
(3R,4R,8S,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,27-trioxa-1,9,21,23-tetraza-8λ5-phosphatricyclo[20.2.2.12,5]heptacosa-16,22,25-triene-11,20,24-trione (PubChem CID 123172347) has the molecular formula C27H34FN4O9P and a molecular weight of 608.56 g/mol. Its IUPAC name is (3R,4R,8S,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,27-trioxa-1,9,21,23-tetraza-8λ5-phosphatricyclo[20.2.2.12,5]heptacosa-16,22,25-triene-11,20,24-trione.
| Compound Name | (3R,4R,8S,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,27-trioxa-1,9,21,23-tetraza-8λ5-phosphatricyclo[20.2.2.12,5]heptacosa-16,22,25-triene-11,20,24-trione |
|---|---|
| PubChem CID | 123172347 |
| Molecular Formula | C27H34FN4O9P |
| Molecular Weight | 608.56 g/mol |
| Exact Mass | 608.20 |
| IUPAC Name | (3R,4R,8S,10S)-3-fluoro-4-hydroxy-3,10-dimethyl-8-oxo-8-phenoxy-7,12,27-trioxa-1,9,21,23-tetraza-8λ5-phosphatricyclo[20.2.2.12,5]heptacosa-16,22,25-triene-11,20,24-trione |
| SMILES | C[C@@H]1N[P@@](=O)(Oc2ccccc2)OCC2OC(n3ccc(nc3=O)NC(=O)CCC=CCCCOC1=O)[C@](C)(F)[C@@H]2O |
| InChI | InChI=1S/C27H34FN4O9P/c1-18-24(35)38-16-10-5-3-4-9-13-22(33)29-21-14-15-32(26(36)30-21)25-27(2,28)23(34)20(40-25)17-39-42(37,31-18)41-19-11-7-6-8-12-19/h3-4,6-8,11-12,14-15,18,20,23,25,34H,5,9-10,13,16-17H2,1-2H3,(H,31,37)(H,29,30,33,36)/t18-,20?,23+,25?,27+,42-/m0/s1 |
| InChIKey | OEJMORBTWIGREU-BOYHFXCISA-N |
| XLogP | 3.02 |
| TPSA | 167.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.56 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|