C15H14BrFN4O — CID 123172540
3-(4-bromo-2-fluorophenyl)-4-isocyano-1-(oxan-4-yl)pyrazol-5-amine (PubChem CID 123172540) has the molecular formula C15H14BrFN4O and a molecular weight of 365.21 g/mol. Its IUPAC name is 3-(4-bromo-2-fluorophenyl)-4-isocyano-1-(oxan-4-yl)pyrazol-5-amine.
| Compound Name | 3-(4-bromo-2-fluorophenyl)-4-isocyano-1-(oxan-4-yl)pyrazol-5-amine |
|---|---|
| PubChem CID | 123172540 |
| Molecular Formula | C15H14BrFN4O |
| Molecular Weight | 365.21 g/mol |
| Exact Mass | 364.03 |
| IUPAC Name | 3-(4-bromo-2-fluorophenyl)-4-isocyano-1-(oxan-4-yl)pyrazol-5-amine |
| SMILES | [C-]#[N+]c1c(-c2ccc(Br)cc2F)nn(C2CCOCC2)c1N |
| InChI | InChI=1S/C15H14BrFN4O/c1-19-14-13(11-3-2-9(16)8-12(11)17)20-21(15(14)18)10-4-6-22-7-5-10/h2-3,8,10H,4-7,18H2 |
| InChIKey | CJCDCNVQJDRGQH-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 57.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.21 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|