C31H26ClN5O2 — CID 123172552
8-[3-(3-chlorophenyl)phenyl]-12-ethyl-11-(4-methoxyanilino)-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9,11-pentaen-7-one (PubChem CID 123172552) has the molecular formula C31H26ClN5O2 and a molecular weight of 536.04 g/mol. Its IUPAC name is 8-[3-(3-chlorophenyl)phenyl]-12-ethyl-11-(4-methoxyanilino)-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9,11-pentaen-7-one.
| Compound Name | 8-[3-(3-chlorophenyl)phenyl]-12-ethyl-11-(4-methoxyanilino)-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9,11-pentaen-7-one |
|---|---|
| PubChem CID | 123172552 |
| Molecular Formula | C31H26ClN5O2 |
| Molecular Weight | 536.04 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 8-[3-(3-chlorophenyl)phenyl]-12-ethyl-11-(4-methoxyanilino)-3,4,8,10-tetrazatricyclo[7.5.0.02,6]tetradeca-1(14),2(6),4,9,11-pentaen-7-one |
| SMILES | CCC1=C(Nc2ccc(OC)cc2)N=c2c(c3[nH]ncc3c(=O)n2-c2cccc(-c3cccc(Cl)c3)c2)=CC1 |
| InChI | InChI=1S/C31H26ClN5O2/c1-3-19-10-15-26-28-27(18-33-36-28)31(38)37(24-9-5-7-21(17-24)20-6-4-8-22(32)16-20)30(26)35-29(19)34-23-11-13-25(39-2)14-12-23/h4-9,11-18,34H,3,10H2,1-2H3,(H,33,36) |
| InChIKey | OJNDPTIPVDVTAT-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.04 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |