C17H18F2N4O2S — CID 123172568
4-[1-[[5-[1-(difluoromethylimino)-3-iminopropan-2-yl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one (PubChem CID 123172568) has the molecular formula C17H18F2N4O2S and a molecular weight of 380.42 g/mol. Its IUPAC name is 4-[1-[[5-[1-(difluoromethylimino)-3-iminopropan-2-yl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one.
| Compound Name | 4-[1-[[5-[1-(difluoromethylimino)-3-iminopropan-2-yl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 123172568 |
| Molecular Formula | C17H18F2N4O2S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 4-[1-[[5-[1-(difluoromethylimino)-3-iminopropan-2-yl]-1,3-benzothiazol-7-yl]oxy]ethyl]pyrrolidin-2-one |
| SMILES | [H]/N=C/C(C=NC(F)F)c1cc(OC(C)C2CNC(=O)C2)c2scnc2c1 |
| InChI | InChI=1S/C17H18F2N4O2S/c1-9(11-4-15(24)21-6-11)25-14-3-10(2-13-16(14)26-8-23-13)12(5-20)7-22-17(18)19/h2-3,5,7-9,11-12,17,20H,4,6H2,1H3,(H,21,24)/b20-5+,22-7? |
| InChIKey | HAANEBBUWIQIHK-HOXWWMBJSA-N |
| XLogP | 3.23 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|