About 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane
2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane (PubChem CID 123172760) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane.
Molecular Properties
| Compound Name | 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane |
| PubChem CID | 123172760 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane |
| SMILES | CC=CC(=CC)N1CC2C1CN2C |
| InChI | InChI=1S/C11H18N2/c1-4-6-9(5-2)13-8-10-11(13)7-12(10)3/h4-6,10-11H,7-8H2,1-3H3 |
| InChIKey | CVJBAZBHHQDCLJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane?
The IUPAC name of 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane (CID 123172760) is 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane.
What is the SMILES notation for 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane?
The canonical SMILES for 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane is CC=CC(=CC)N1CC2C1CN2C.
What is the InChIKey of 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane?
The InChIKey is CVJBAZBHHQDCLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2/c1-4-6-9(5-2)13-8-10-11(13)7-12(10)3/h4-6,10-11H,7-8H2,1-3H3.
What are the key properties of 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane?
2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane has a molecular weight of 178.28 g/mol, XLogP of 1.46, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hexa-2,4-dien-3-yl-5-methyl-2,5-diazabicyclo[2.2.0]hexane is sourced from PubChem (CID 123172760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).