C9H30O6Si6 — CID 123172811
2,4,6-triethyl-8,10,12-trimethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 123172811) has the molecular formula C9H30O6Si6 and a molecular weight of 402.85 g/mol. Its IUPAC name is 2,4,6-triethyl-8,10,12-trimethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,4,6-triethyl-8,10,12-trimethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 123172811 |
| Molecular Formula | C9H30O6Si6 |
| Molecular Weight | 402.85 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | 2,4,6-triethyl-8,10,12-trimethyl-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | CC[SiH]1O[SiH](C)O[SiH](C)O[SiH](C)O[SiH](CC)O[SiH](CC)O1 |
| InChI | InChI=1S/C9H30O6Si6/c1-7-19-12-17(5)10-16(4)11-18(6)13-20(8-2)15-21(9-3)14-19/h16-21H,7-9H2,1-6H3 |
| InChIKey | TWQGRPMQYWCQKN-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.85 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|