C40H40BN5O3 — CID 123172939
4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridin-3-yl]-2-pyridinyl]morpholine (PubChem CID 123172939) has the molecular formula C40H40BN5O3 and a molecular weight of 649.60 g/mol. Its IUPAC name is 4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridin-3-yl]-2-pyridinyl]morpholine.
| Compound Name | 4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridin-3-yl]-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 123172939 |
| Molecular Formula | C40H40BN5O3 |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 649.32 |
| IUPAC Name | 4-[4-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazolo[5,4-b]pyridin-3-yl]-2-pyridinyl]morpholine |
| SMILES | CC1(C)OB(c2cnc3c(c2)c(-c2ccnc(N4CCOCC4)c2)nn3C(c2ccccc2)(c2ccccc2)c2ccccc2)OC1(C)C |
| InChI | InChI=1S/C40H40BN5O3/c1-38(2)39(3,4)49-41(48-38)33-27-34-36(29-20-21-42-35(26-29)45-22-24-47-25-23-45)44-46(37(34)43-28-33)40(30-14-8-5-9-15-30,31-16-10-6-11-17-31)32-18-12-7-13-19-32/h5-21,26-28H,22-25H2,1-4H3 |
| InChIKey | PQAQUQIOWNAXFL-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 74.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|