About 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole
9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole (PubChem CID 123172961) has the molecular formula C13H11N
and a molecular weight of 181.24 g/mol. Its IUPAC name is 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole.
Molecular Properties
| Compound Name | 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole |
| PubChem CID | 123172961 |
| Molecular Formula | C13H11N |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole |
| SMILES | CN1c2cc#ccc2C2C=CC=CC21 |
| InChI | InChI=1S/C13H11N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,6-10,12H,1H3 |
| InChIKey | GBYHHKWOZXARAW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole?
The IUPAC name of 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole (CID 123172961) is 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole.
What is the SMILES notation for 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole?
The canonical SMILES for 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole is CN1c2cc#ccc2C2C=CC=CC21.
What is the InChIKey of 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole?
The InChIKey is GBYHHKWOZXARAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11N/c1-14-12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,6-10,12H,1H3.
What are the key properties of 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole?
9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole has a molecular weight of 181.24 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6,7-didehydro-4a,9a-dihydrocarbazole is sourced from PubChem (CID 123172961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).