About 5-methylsulfinyl-1,2,3,4-tetrahydropyridine
5-methylsulfinyl-1,2,3,4-tetrahydropyridine (PubChem CID 123173145) has the molecular formula C6H11NOS
and a molecular weight of 145.23 g/mol. Its IUPAC name is 5-methylsulfinyl-1,2,3,4-tetrahydropyridine.
Molecular Properties
| Compound Name | 5-methylsulfinyl-1,2,3,4-tetrahydropyridine |
| PubChem CID | 123173145 |
| Molecular Formula | C6H11NOS |
| Molecular Weight | 145.23 g/mol |
| Exact Mass | 145.06 |
| IUPAC Name | 5-methylsulfinyl-1,2,3,4-tetrahydropyridine |
| SMILES | CS(=O)C1=CNCCC1 |
| InChI | InChI=1S/C6H11NOS/c1-9(8)6-3-2-4-7-5-6/h5,7H,2-4H2,1H3 |
| InChIKey | PFPSDBPLIVHRBQ-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.23 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methylsulfinyl-1,2,3,4-tetrahydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methylsulfinyl-1,2,3,4-tetrahydropyridine?
The IUPAC name of 5-methylsulfinyl-1,2,3,4-tetrahydropyridine (CID 123173145) is 5-methylsulfinyl-1,2,3,4-tetrahydropyridine.
What is the SMILES notation for 5-methylsulfinyl-1,2,3,4-tetrahydropyridine?
The canonical SMILES for 5-methylsulfinyl-1,2,3,4-tetrahydropyridine is CS(=O)C1=CNCCC1.
What is the InChIKey of 5-methylsulfinyl-1,2,3,4-tetrahydropyridine?
The InChIKey is PFPSDBPLIVHRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11NOS/c1-9(8)6-3-2-4-7-5-6/h5,7H,2-4H2,1H3.
What are the key properties of 5-methylsulfinyl-1,2,3,4-tetrahydropyridine?
5-methylsulfinyl-1,2,3,4-tetrahydropyridine has a molecular weight of 145.23 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylsulfinyl-1,2,3,4-tetrahydropyridine is sourced from PubChem (CID 123173145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).