C13H23FN2O2 — CID 123173205
tert-butyl (3aS,6aR)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate (PubChem CID 123173205) has the molecular formula C13H23FN2O2 and a molecular weight of 258.34 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 123173205 |
| Molecular Formula | C13H23FN2O2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-(aminomethyl)-5-fluoro-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]2CC(F)(CN)C[C@@H]2C1 |
| InChI | InChI=1S/C13H23FN2O2/c1-12(2,3)18-11(17)16-6-9-4-13(14,8-15)5-10(9)7-16/h9-10H,4-8,15H2,1-3H3/t9-,10+,13? |
| InChIKey | OCKHFXGODSIQKV-HWYHXSKPSA-N |
| XLogP | 1.93 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |