C23H26FN5O4 — CID 123173319
N-[1-(4-carbamoylcyclohexyl)-6-(2-methoxyethoxy)imidazo[4,5-c]pyridin-2-yl]-4-fluorobenzamide (PubChem CID 123173319) has the molecular formula C23H26FN5O4 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[1-(4-carbamoylcyclohexyl)-6-(2-methoxyethoxy)imidazo[4,5-c]pyridin-2-yl]-4-fluorobenzamide.
| Compound Name | N-[1-(4-carbamoylcyclohexyl)-6-(2-methoxyethoxy)imidazo[4,5-c]pyridin-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 123173319 |
| Molecular Formula | C23H26FN5O4 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | N-[1-(4-carbamoylcyclohexyl)-6-(2-methoxyethoxy)imidazo[4,5-c]pyridin-2-yl]-4-fluorobenzamide |
| SMILES | COCCOc1cc2c(cn1)nc(NC(=O)c1ccc(F)cc1)n2C1CCC(C(N)=O)CC1 |
| InChI | InChI=1S/C23H26FN5O4/c1-32-10-11-33-20-12-19-18(13-26-20)27-23(28-22(31)15-2-6-16(24)7-3-15)29(19)17-8-4-14(5-9-17)21(25)30/h2-3,6-7,12-14,17H,4-5,8-11H2,1H3,(H2,25,30)(H,27,28,31) |
| InChIKey | WTJGPDILZQRRSZ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 121.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|