C17H23FO — CID 123173749
4-fluoro-2,6-dimethyl-5-(6-methylhepta-2,4,6-trien-3-yloxy)hepta-1,3,5-triene (PubChem CID 123173749) has the molecular formula C17H23FO and a molecular weight of 262.37 g/mol. Its IUPAC name is 4-fluoro-2,6-dimethyl-5-(6-methylhepta-2,4,6-trien-3-yloxy)hepta-1,3,5-triene.
| Compound Name | 4-fluoro-2,6-dimethyl-5-(6-methylhepta-2,4,6-trien-3-yloxy)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 123173749 |
| Molecular Formula | C17H23FO |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | 4-fluoro-2,6-dimethyl-5-(6-methylhepta-2,4,6-trien-3-yloxy)hepta-1,3,5-triene |
| SMILES | C=C(C)C=CC(=CC)OC(C(F)=CC(=C)C)=C(C)C |
| InChI | InChI=1S/C17H23FO/c1-8-15(10-9-12(2)3)19-17(14(6)7)16(18)11-13(4)5/h8-11H,2,4H2,1,3,5-7H3 |
| InChIKey | WWVFBBSHDGKYSW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|