C15H24NO4P — CID 123174553
6-methyl-4-[1-[5-(phosphanyloxymethyl)oxolan-2-yl]propan-2-yl]-3,4-dihydroazepine-2,7-dione (PubChem CID 123174553) has the molecular formula C15H24NO4P and a molecular weight of 313.33 g/mol. Its IUPAC name is 6-methyl-4-[1-[5-(phosphanyloxymethyl)oxolan-2-yl]propan-2-yl]-3,4-dihydroazepine-2,7-dione.
| Compound Name | 6-methyl-4-[1-[5-(phosphanyloxymethyl)oxolan-2-yl]propan-2-yl]-3,4-dihydroazepine-2,7-dione |
|---|---|
| PubChem CID | 123174553 |
| Molecular Formula | C15H24NO4P |
| Molecular Weight | 313.33 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 6-methyl-4-[1-[5-(phosphanyloxymethyl)oxolan-2-yl]propan-2-yl]-3,4-dihydroazepine-2,7-dione |
| SMILES | CC1=CC(C(C)CC2CCC(COP)O2)CC(=O)NC1=O |
| InChI | InChI=1S/C15H24NO4P/c1-9(6-12-3-4-13(20-12)8-19-21)11-5-10(2)15(18)16-14(17)7-11/h5,9,11-13H,3-4,6-8,21H2,1-2H3,(H,16,17,18) |
| InChIKey | WDDFQRUTLOCFJG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.33 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|