About 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid
4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid (PubChem CID 123174719) has the molecular formula C14H6FN3O4
and a molecular weight of 299.22 g/mol. Its IUPAC name is 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid.
Molecular Properties
| Compound Name | 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid |
| PubChem CID | 123174719 |
| Molecular Formula | C14H6FN3O4 |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid |
| SMILES | N#Cc1nc(C(=O)O)c(O)c2onc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C14H6FN3O4/c15-7-3-1-6(2-4-7)10-9-8(5-16)17-11(14(20)21)12(19)13(9)22-18-10/h1-4,19H,(H,20,21) |
| InChIKey | FZLYPXJSJCFLLK-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid?
The IUPAC name of 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid (CID 123174719) is 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid.
What is the SMILES notation for 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid?
The canonical SMILES for 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid is N#Cc1nc(C(=O)O)c(O)c2onc(-c3ccc(F)cc3)c12.
What is the InChIKey of 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid?
The InChIKey is FZLYPXJSJCFLLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H6FN3O4/c15-7-3-1-6(2-4-7)10-9-8(5-16)17-11(14(20)21)12(19)13(9)22-18-10/h1-4,19H,(H,20,21).
What are the key properties of 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid?
4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid has a molecular weight of 299.22 g/mol, XLogP of 2.30, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyano-3-(4-fluorophenyl)-7-hydroxy-[1,2]oxazolo[4,5-c]pyridine-6-carboxylic acid is sourced from PubChem (CID 123174719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).