C18H11ClF4N2O2S2 — CID 123174762
3-chloro-6-fluoro-N-[[1,1,1-trifluoro-4-(5-methylthiophen-2-yl)-4-oxobutan-2-ylidene]amino]-1-benzothiophene-2-carboxamide (PubChem CID 123174762) has the molecular formula C18H11ClF4N2O2S2 and a molecular weight of 462.88 g/mol. Its IUPAC name is 3-chloro-6-fluoro-N-[[1,1,1-trifluoro-4-(5-methylthiophen-2-yl)-4-oxobutan-2-ylidene]amino]-1-benzothiophene-2-carboxamide.
| Compound Name | 3-chloro-6-fluoro-N-[[1,1,1-trifluoro-4-(5-methylthiophen-2-yl)-4-oxobutan-2-ylidene]amino]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 123174762 |
| Molecular Formula | C18H11ClF4N2O2S2 |
| Molecular Weight | 462.88 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 3-chloro-6-fluoro-N-[[1,1,1-trifluoro-4-(5-methylthiophen-2-yl)-4-oxobutan-2-ylidene]amino]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(C(=O)CC(=NNC(=O)c2sc3cc(F)ccc3c2Cl)C(F)(F)F)s1 |
| InChI | InChI=1S/C18H11ClF4N2O2S2/c1-8-2-5-12(28-8)11(26)7-14(18(21,22)23)24-25-17(27)16-15(19)10-4-3-9(20)6-13(10)29-16/h2-6H,7H2,1H3,(H,25,27) |
| InChIKey | VWZUEGWVPNJMTC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.88 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|