About (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane
(5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane (PubChem CID 123175296) has the molecular formula C29H28N2P2
and a molecular weight of 466.51 g/mol. Its IUPAC name is (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane.
Molecular Properties
| Compound Name | (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane |
| PubChem CID | 123175296 |
| Molecular Formula | C29H28N2P2 |
| Molecular Weight | 466.51 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane |
| SMILES | CN1CN(C)C(P(c2ccccc2)c2ccccc2)=C1P(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H28N2P2/c1-30-23-31(2)29(33(26-19-11-5-12-20-26)27-21-13-6-14-22-27)28(30)32(24-15-7-3-8-16-24)25-17-9-4-10-18-25/h3-22H,23H2,1-2H3 |
| InChIKey | NOSONGGUMKQTCJ-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 466.51 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane?
The IUPAC name of (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane (CID 123175296) is (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane.
What is the SMILES notation for (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane?
The canonical SMILES for (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane is CN1CN(C)C(P(c2ccccc2)c2ccccc2)=C1P(c1ccccc1)c1ccccc1.
What is the InChIKey of (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane?
The InChIKey is NOSONGGUMKQTCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H28N2P2/c1-30-23-31(2)29(33(26-19-11-5-12-20-26)27-21-13-6-14-22-27)28(30)32(24-15-7-3-8-16-24)25-17-9-4-10-18-25/h3-22H,23H2,1-2H3.
What are the key properties of (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane?
(5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane has a molecular weight of 466.51 g/mol, XLogP of 5.21, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-diphenylphosphanyl-1,3-dimethyl-2H-imidazol-4-yl)-diphenylphosphane is sourced from PubChem (CID 123175296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).