C16H27N7O — CID 123175389
3-[2-[(dimethylamino)methyl]morpholin-4-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide (PubChem CID 123175389) has the molecular formula C16H27N7O and a molecular weight of 333.44 g/mol. Its IUPAC name is 3-[2-[(dimethylamino)methyl]morpholin-4-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide.
| Compound Name | 3-[2-[(dimethylamino)methyl]morpholin-4-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide |
|---|---|
| PubChem CID | 123175389 |
| Molecular Formula | C16H27N7O |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | 3-[2-[(dimethylamino)methyl]morpholin-4-yl]-3-imino-N'-[5-[(E)-prop-1-enyl]-1H-pyrazol-3-yl]propanimidamide |
| SMILES | [H]/N=C(\C/C(N)=N/c1cc(/C=C/C)[nH]n1)N1CCOC(CN(C)C)C1 |
| InChI | InChI=1S/C16H27N7O/c1-4-5-12-8-16(21-20-12)19-14(17)9-15(18)23-6-7-24-13(11-23)10-22(2)3/h4-5,8,13,18H,6-7,9-11H2,1-3H3,(H3,17,19,20,21)/b5-4+,18-15+ |
| InChIKey | DHZMJZMCCRZMJL-UUMYTVSKSA-N |
| XLogP | 1.06 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|