C22H30O4 — CID 123175889
10-ethenyl-21,21-dimethyl-9,11,17-trioxahexacyclo[14.3.1.13,7.01,13.08,12.018,20]henicos-6-en-3-ol (PubChem CID 123175889) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is 10-ethenyl-21,21-dimethyl-9,11,17-trioxahexacyclo[14.3.1.13,7.01,13.08,12.018,20]henicos-6-en-3-ol.
| Compound Name | 10-ethenyl-21,21-dimethyl-9,11,17-trioxahexacyclo[14.3.1.13,7.01,13.08,12.018,20]henicos-6-en-3-ol |
|---|---|
| PubChem CID | 123175889 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | 10-ethenyl-21,21-dimethyl-9,11,17-trioxahexacyclo[14.3.1.13,7.01,13.08,12.018,20]henicos-6-en-3-ol |
| SMILES | C=CC1OC2C3=CCCC(O)(CC45CC6OC(CCC4C2O1)C65)C3(C)C |
| InChI | InChI=1S/C22H30O4/c1-4-16-25-18-12-6-5-9-22(23,20(12,2)3)11-21-10-15-17(21)14(24-15)8-7-13(21)19(18)26-16/h4,6,13-19,23H,1,5,7-11H2,2-3H3 |
| InChIKey | MBTCQBOEYCVMKE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|