About N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine
N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine (PubChem CID 123176778) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine.
Molecular Properties
| Compound Name | N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine |
| PubChem CID | 123176778 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine |
| SMILES | CCc1ncc2ccnc(N(C)CC)c2n1 |
| InChI | InChI=1S/C12H16N4/c1-4-10-14-8-9-6-7-13-12(11(9)15-10)16(3)5-2/h6-8H,4-5H2,1-3H3 |
| InChIKey | DTURXCVRNULHQT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine?
The IUPAC name of N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine (CID 123176778) is N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine.
What is the SMILES notation for N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine?
The canonical SMILES for N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine is CCc1ncc2ccnc(N(C)CC)c2n1.
What is the InChIKey of N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine?
The InChIKey is DTURXCVRNULHQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N4/c1-4-10-14-8-9-6-7-13-12(11(9)15-10)16(3)5-2/h6-8H,4-5H2,1-3H3.
What are the key properties of N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine?
N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine has a molecular weight of 216.29 g/mol, XLogP of 2.04, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-N-methylpyrido[3,4-d]pyrimidin-8-amine is sourced from PubChem (CID 123176778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).