About [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate
[[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate (PubChem CID 123177080) has the molecular formula C14H19NO3
and a molecular weight of 249.31 g/mol. Its IUPAC name is [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate.
Molecular Properties
| Compound Name | [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate |
| PubChem CID | 123177080 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate |
| SMILES | CC/C=C1/C(=O)C(=NOC(C)=O)C/C1=C/C(C)C |
| InChI | InChI=1S/C14H19NO3/c1-5-6-12-11(7-9(2)3)8-13(14(12)17)15-18-10(4)16/h6-7,9H,5,8H2,1-4H3/b11-7-,12-6+,15-13? |
| InChIKey | DNRKUASCNSKSFU-KFHHBPFASA-N |
| XLogP | 2.80 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate?
The IUPAC name of [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate (CID 123177080) is [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate.
What is the SMILES notation for [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate?
The canonical SMILES for [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate is CC/C=C1/C(=O)C(=NOC(C)=O)C/C1=C/C(C)C.
What is the InChIKey of [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate?
The InChIKey is DNRKUASCNSKSFU-KFHHBPFASA-N. The full InChI is InChI=1S/C14H19NO3/c1-5-6-12-11(7-9(2)3)8-13(14(12)17)15-18-10(4)16/h6-7,9H,5,8H2,1-4H3/b11-7-,12-6+,15-13?.
What are the key properties of [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate?
[[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate has a molecular weight of 249.31 g/mol, XLogP of 2.80, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [[(3E,4Z)-4-(2-methylpropylidene)-2-oxo-3-propylidenecyclopentylidene]amino] acetate is sourced from PubChem (CID 123177080), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).