About 1-ethoxypropylsilane
1-ethoxypropylsilane (PubChem CID 123177180) has the molecular formula C5H14OSi
and a molecular weight of 118.25 g/mol. Its IUPAC name is 1-ethoxypropylsilane.
Molecular Properties
| Compound Name | 1-ethoxypropylsilane |
| PubChem CID | 123177180 |
| Molecular Formula | C5H14OSi |
| Molecular Weight | 118.25 g/mol |
| Exact Mass | 118.08 |
| IUPAC Name | 1-ethoxypropylsilane |
| SMILES | CCOC([SiH3])CC |
| InChI | InChI=1S/C5H14OSi/c1-3-5(7)6-4-2/h5H,3-4H2,1-2,7H3 |
| InChIKey | OZZYHOKZKDWSDT-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.25 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-ethoxypropylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethoxypropylsilane?
The IUPAC name of 1-ethoxypropylsilane (CID 123177180) is 1-ethoxypropylsilane.
What is the SMILES notation for 1-ethoxypropylsilane?
The canonical SMILES for 1-ethoxypropylsilane is CCOC([SiH3])CC.
What is the InChIKey of 1-ethoxypropylsilane?
The InChIKey is OZZYHOKZKDWSDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H14OSi/c1-3-5(7)6-4-2/h5H,3-4H2,1-2,7H3.
What are the key properties of 1-ethoxypropylsilane?
1-ethoxypropylsilane has a molecular weight of 118.25 g/mol, XLogP of 0.12, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethoxypropylsilane is sourced from PubChem (CID 123177180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).