C25H20FN5OS — CID 123177486
2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-2-yl]thiophen-2-yl]-1-benzofuran-6-carboximidamide (PubChem CID 123177486) has the molecular formula C25H20FN5OS and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-2-yl]thiophen-2-yl]-1-benzofuran-6-carboximidamide.
| Compound Name | 2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-2-yl]thiophen-2-yl]-1-benzofuran-6-carboximidamide |
|---|---|
| PubChem CID | 123177486 |
| Molecular Formula | C25H20FN5OS |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.14 |
| IUPAC Name | 2-[5-[6-(5-fluoro-1,4,5,6-tetrahydropyrimidin-2-yl)-1H-indol-2-yl]thiophen-2-yl]-1-benzofuran-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2cc(-c3ccc(-c4cc5ccc(C6=NCC(F)CN6)cc5[nH]4)s3)oc2c1 |
| InChI | InChI=1S/C25H20FN5OS/c26-17-11-29-25(30-12-17)16-4-1-13-7-19(31-18(13)8-16)22-5-6-23(33-22)21-9-14-2-3-15(24(27)28)10-20(14)32-21/h1-10,17,31H,11-12H2,(H3,27,28)(H,29,30) |
| InChIKey | FWIJGZOYOXLDSH-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|