C11H20N2S — CID 123177897
(E,E)-N-(methylideneamino)-6-(methylsulfanylmethyl)oct-5-en-4-imine (PubChem CID 123177897) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is (E,E)-N-(methylideneamino)-6-(methylsulfanylmethyl)oct-5-en-4-imine.
| Compound Name | (E,E)-N-(methylideneamino)-6-(methylsulfanylmethyl)oct-5-en-4-imine |
|---|---|
| PubChem CID | 123177897 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | (E,E)-N-(methylideneamino)-6-(methylsulfanylmethyl)oct-5-en-4-imine |
| SMILES | C=N/N=C(/C=C(\CC)CSC)CCC |
| InChI | InChI=1S/C11H20N2S/c1-5-7-11(13-12-3)8-10(6-2)9-14-4/h8H,3,5-7,9H2,1-2,4H3/b10-8+,13-11+ |
| InChIKey | BMHRCPPHZGBRIN-HATNNVTISA-N |
| XLogP | 3.54 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|