About 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol
1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol (PubChem CID 123177954) has the molecular formula C15H27N3O3
and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol |
| PubChem CID | 123177954 |
| Molecular Formula | C15H27N3O3 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN(Cc1cocn1)CC1CCCNCC1 |
| InChI | InChI=1S/C15H27N3O3/c1-20-11-15(19)9-18(8-14-10-21-12-17-14)7-13-3-2-5-16-6-4-13/h10,12-13,15-16,19H,2-9,11H2,1H3 |
| InChIKey | ZFRTUEYXMADJBC-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 70.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol (CID 123177954) is 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol is COCC(O)CN(Cc1cocn1)CC1CCCNCC1.
What is the InChIKey of 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol?
The InChIKey is ZFRTUEYXMADJBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27N3O3/c1-20-11-15(19)9-18(8-14-10-21-12-17-14)7-13-3-2-5-16-6-4-13/h10,12-13,15-16,19H,2-9,11H2,1H3.
What are the key properties of 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol?
1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol has a molecular weight of 297.40 g/mol, XLogP of 0.87, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[azepan-4-ylmethyl(1,3-oxazol-4-ylmethyl)amino]-3-methoxypropan-2-ol is sourced from PubChem (CID 123177954), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).