About [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol
[3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol (PubChem CID 123178003) has the molecular formula C24H31BrO4
and a molecular weight of 463.41 g/mol. Its IUPAC name is [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol.
Molecular Properties
| Compound Name | [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol |
| PubChem CID | 123178003 |
| Molecular Formula | C24H31BrO4 |
| Molecular Weight | 463.41 g/mol |
| Exact Mass | 462.14 |
| IUPAC Name | [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol |
| SMILES | OCc1cccc(-c2cc(Br)cc(OCCCCCCCCC3OCCO3)c2)c1 |
| InChI | InChI=1S/C24H31BrO4/c25-22-15-21(20-9-7-8-19(14-20)18-26)16-23(17-22)27-11-6-4-2-1-3-5-10-24-28-12-13-29-24/h7-9,14-17,24,26H,1-6,10-13,18H2 |
| InChIKey | QCCRKSHAUZGJLM-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 463.41 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol?
The IUPAC name of [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol (CID 123178003) is [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol.
What is the SMILES notation for [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol?
The canonical SMILES for [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol is OCc1cccc(-c2cc(Br)cc(OCCCCCCCCC3OCCO3)c2)c1.
What is the InChIKey of [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol?
The InChIKey is QCCRKSHAUZGJLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31BrO4/c25-22-15-21(20-9-7-8-19(14-20)18-26)16-23(17-22)27-11-6-4-2-1-3-5-10-24-28-12-13-29-24/h7-9,14-17,24,26H,1-6,10-13,18H2.
What are the key properties of [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol?
[3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol has a molecular weight of 463.41 g/mol, XLogP of 6.09, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[3-bromo-5-[8-(1,3-dioxolan-2-yl)octoxy]phenyl]phenyl]methanol is sourced from PubChem (CID 123178003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).