C16H19FN2O3 — CID 123178100
5-fluoro-1-[(5-propyloxolan-3-yl)methyl]indazole-3-carboxylic acid (PubChem CID 123178100) has the molecular formula C16H19FN2O3 and a molecular weight of 306.34 g/mol. Its IUPAC name is 5-fluoro-1-[(5-propyloxolan-3-yl)methyl]indazole-3-carboxylic acid.
| Compound Name | 5-fluoro-1-[(5-propyloxolan-3-yl)methyl]indazole-3-carboxylic acid |
|---|---|
| PubChem CID | 123178100 |
| Molecular Formula | C16H19FN2O3 |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.14 |
| IUPAC Name | 5-fluoro-1-[(5-propyloxolan-3-yl)methyl]indazole-3-carboxylic acid |
| SMILES | CCCC1CC(Cn2nc(C(=O)O)c3cc(F)ccc32)CO1 |
| InChI | InChI=1S/C16H19FN2O3/c1-2-3-12-6-10(9-22-12)8-19-14-5-4-11(17)7-13(14)15(18-19)16(20)21/h4-5,7,10,12H,2-3,6,8-9H2,1H3,(H,20,21) |
| InChIKey | DELGKNDMKUEXGL-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |