About N-cyclohexa-1,5-dien-1-yl-8-oxononanamide
N-cyclohexa-1,5-dien-1-yl-8-oxononanamide (PubChem CID 123178167) has the molecular formula C15H23NO2
and a molecular weight of 249.35 g/mol. Its IUPAC name is N-cyclohexa-1,5-dien-1-yl-8-oxononanamide.
Molecular Properties
| Compound Name | N-cyclohexa-1,5-dien-1-yl-8-oxononanamide |
| PubChem CID | 123178167 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-cyclohexa-1,5-dien-1-yl-8-oxononanamide |
| SMILES | CC(=O)CCCCCCC(=O)NC1=CCCC=C1 |
| InChI | InChI=1S/C15H23NO2/c1-13(17)9-5-2-3-8-12-15(18)16-14-10-6-4-7-11-14/h6,10-11H,2-5,7-9,12H2,1H3,(H,16,18) |
| InChIKey | YRVLZXJASUQAIU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexa-1,5-dien-1-yl-8-oxononanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexa-1,5-dien-1-yl-8-oxononanamide?
The IUPAC name of N-cyclohexa-1,5-dien-1-yl-8-oxononanamide (CID 123178167) is N-cyclohexa-1,5-dien-1-yl-8-oxononanamide.
What is the SMILES notation for N-cyclohexa-1,5-dien-1-yl-8-oxononanamide?
The canonical SMILES for N-cyclohexa-1,5-dien-1-yl-8-oxononanamide is CC(=O)CCCCCCC(=O)NC1=CCCC=C1.
What is the InChIKey of N-cyclohexa-1,5-dien-1-yl-8-oxononanamide?
The InChIKey is YRVLZXJASUQAIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2/c1-13(17)9-5-2-3-8-12-15(18)16-14-10-6-4-7-11-14/h6,10-11H,2-5,7-9,12H2,1H3,(H,16,18).
What are the key properties of N-cyclohexa-1,5-dien-1-yl-8-oxononanamide?
N-cyclohexa-1,5-dien-1-yl-8-oxononanamide has a molecular weight of 249.35 g/mol, XLogP of 3.27, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexa-1,5-dien-1-yl-8-oxononanamide is sourced from PubChem (CID 123178167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).