C32H37N5O5Si — CID 123178584
methyl 3-[[5-[4-[5-(4-cyanophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate (PubChem CID 123178584) has the molecular formula C32H37N5O5Si and a molecular weight of 599.76 g/mol. Its IUPAC name is methyl 3-[[5-[4-[5-(4-cyanophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate.
| Compound Name | methyl 3-[[5-[4-[5-(4-cyanophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 123178584 |
| Molecular Formula | C32H37N5O5Si |
| Molecular Weight | 599.76 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | methyl 3-[[5-[4-[5-(4-cyanophenoxy)-1-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-yl]phenyl]-2-pyridinyl]oxy]-2,2-dimethylpropanoate |
| SMILES | COC(=O)C(C)(C)COc1ccc(-c2ccc(-c3nc(Oc4ccc(C#N)cc4)n(COCC[Si](C)(C)C)n3)cc2)cn1 |
| InChI | InChI=1S/C32H37N5O5Si/c1-32(2,30(38)39-3)21-41-28-16-13-26(20-34-28)24-9-11-25(12-10-24)29-35-31(42-27-14-7-23(19-33)8-15-27)37(36-29)22-40-17-18-43(4,5)6/h7-16,20H,17-18,21-22H2,1-6H3 |
| InChIKey | PWZIXAQLVNBJPN-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 121.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.76 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|