C19H19N5O3 — CID 123178732
6-[4-[(4-amino-3-methanimidoyl-2-pyridinyl)oxy]-2-methylphenyl]-1,5-dimethylpyrimidine-2,4-dione (PubChem CID 123178732) has the molecular formula C19H19N5O3 and a molecular weight of 365.39 g/mol. Its IUPAC name is 6-[4-[(4-amino-3-methanimidoyl-2-pyridinyl)oxy]-2-methylphenyl]-1,5-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[4-[(4-amino-3-methanimidoyl-2-pyridinyl)oxy]-2-methylphenyl]-1,5-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 123178732 |
| Molecular Formula | C19H19N5O3 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 6-[4-[(4-amino-3-methanimidoyl-2-pyridinyl)oxy]-2-methylphenyl]-1,5-dimethylpyrimidine-2,4-dione |
| SMILES | [H]/N=C/c1c(N)ccnc1Oc1ccc(-c2c(C)c(=O)[nH]c(=O)n2C)c(C)c1 |
| InChI | InChI=1S/C19H19N5O3/c1-10-8-12(27-18-14(9-20)15(21)6-7-22-18)4-5-13(10)16-11(2)17(25)23-19(26)24(16)3/h4-9,20H,1-3H3,(H2,21,22)(H,23,25,26)/b20-9+ |
| InChIKey | UGXIEURFLKICDF-AWQFTUOYSA-N |
| XLogP | 2.12 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|